C19H24O4 — CID 67490782
3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-oxopropanoic acid (PubChem CID 67490782) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-oxopropanoic acid.
| Compound Name | 3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 67490782 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-oxopropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc(CC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C19H24O4/c1-14(2)5-4-6-15(3)11-12-23-17-9-7-16(8-10-17)13-18(20)19(21)22/h5,7-11H,4,6,12-13H2,1-3H3,(H,21,22)/b15-11+ |
| InChIKey | GZPFMVDEVDKKSA-RVDMUPIBSA-N |
| XLogP | 3.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|