C17H22O4 — CID 54278748
4-(3,7-dimethylocta-2,6-dienoxy)-2-hydroxybenzoic acid (PubChem CID 54278748) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)-2-hydroxybenzoic acid.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54278748 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)-2-hydroxybenzoic acid |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C17H22O4/c1-12(2)5-4-6-13(3)9-10-21-14-7-8-15(17(19)20)16(18)11-14/h5,7-9,11,18H,4,6,10H2,1-3H3,(H,19,20) |
| InChIKey | RPHGPEPWDJACFX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|