C19H27NO4 — CID 69130580
4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-hydroxy-N-(2-hydroxyethyl)benzamide (PubChem CID 69130580) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-hydroxy-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-hydroxy-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 69130580 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-hydroxy-N-(2-hydroxyethyl)benzamide |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc(C(=O)NCCO)c(O)c1 |
| InChI | InChI=1S/C19H27NO4/c1-14(2)5-4-6-15(3)9-12-24-16-7-8-17(18(22)13-16)19(23)20-10-11-21/h5,7-9,13,21-22H,4,6,10-12H2,1-3H3,(H,20,23)/b15-9+ |
| InChIKey | OILFBNDTFMJJMQ-OQLLNIDSSA-N |
| XLogP | 3.19 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|