C27H32O5 — CID 100960826
(E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 100960826) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 100960826 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCOc1ccc(/C=C/C(=O)c2ccc(OC/C=C(\C)CCC=C(C)C)cc2)c(O)c1 |
| InChI | InChI=1S/C27H32O5/c1-20(2)6-5-7-21(3)16-17-31-24-12-8-22(9-13-24)26(28)15-11-23-10-14-25(18-27(23)29)32-19-30-4/h6,8-16,18,29H,5,7,17,19H2,1-4H3/b15-11+,21-16+ |
| InChIKey | ZRMCESRZHJQEEM-BAWSUDPCSA-N |
| XLogP | 6.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|