C15H20O5 — CID 139988139
tert-butyl 3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-enoate (PubChem CID 139988139) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl 3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139988139 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | tert-butyl 3-[2-hydroxy-4-(methoxymethoxy)phenyl]prop-2-enoate |
| SMILES | COCOc1ccc(C=CC(=O)OC(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C15H20O5/c1-15(2,3)20-14(17)8-6-11-5-7-12(9-13(11)16)19-10-18-4/h5-9,16H,10H2,1-4H3 |
| InChIKey | KGRFFQWYAIZCRS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|