C16H19ClO4 — CID 69121713
tert-butyl 3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate (PubChem CID 69121713) has the molecular formula C16H19ClO4 and a molecular weight of 310.78 g/mol. Its IUPAC name is tert-butyl 3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69121713 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | tert-butyl 3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)Cc1cc(Cl)ccc1C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19ClO4/c1-16(2,3)21-14(18)8-6-11-5-7-13(17)9-12(11)10-15(19)20-4/h5-9H,10H2,1-4H3 |
| InChIKey | SFOQMVFGSWMARM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|