C14H16Cl2O3 — CID 123152558
tert-butyl 3-(2,5-dichloro-4-methoxyphenyl)prop-2-enoate (PubChem CID 123152558) has the molecular formula C14H16Cl2O3 and a molecular weight of 303.19 g/mol. Its IUPAC name is tert-butyl 3-(2,5-dichloro-4-methoxyphenyl)prop-2-enoate.
| Compound Name | tert-butyl 3-(2,5-dichloro-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123152558 |
| Molecular Formula | C14H16Cl2O3 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | tert-butyl 3-(2,5-dichloro-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(Cl)c(C=CC(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C14H16Cl2O3/c1-14(2,3)19-13(17)6-5-9-7-11(16)12(18-4)8-10(9)15/h5-8H,1-4H3 |
| InChIKey | SYVFDILPQDZLPJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|