C15H14ClF3N4O2 — CID 66939179
tert-butyl 3-[5-chloro-2-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]prop-2-enoate (PubChem CID 66939179) has the molecular formula C15H14ClF3N4O2 and a molecular weight of 374.75 g/mol. Its IUPAC name is tert-butyl 3-[5-chloro-2-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[5-chloro-2-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 66939179 |
| Molecular Formula | C15H14ClF3N4O2 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | tert-butyl 3-[5-chloro-2-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1cc(Cl)ccc1-n1nnnc1C(F)(F)F |
| InChI | InChI=1S/C15H14ClF3N4O2/c1-14(2,3)25-12(24)7-4-9-8-10(16)5-6-11(9)23-13(15(17,18)19)20-21-22-23/h4-8H,1-3H3 |
| InChIKey | KXDJXOCFNCUUQF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|