C32H39BrCl2O8 — CID 162101100
tert-butyl (E)-3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate;tert-butyl prop-2-enoate;methyl 2-(2-bromo-5-chlorophenyl)acetate (PubChem CID 162101100) has the molecular formula C32H39BrCl2O8 and a molecular weight of 702.47 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate;tert-butyl prop-2-enoate;methyl 2-(2-bromo-5-chlorophenyl)acetate.
| Compound Name | tert-butyl (E)-3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate;tert-butyl prop-2-enoate;methyl 2-(2-bromo-5-chlorophenyl)acetate |
|---|---|
| PubChem CID | 162101100 |
| Molecular Formula | C32H39BrCl2O8 |
| Molecular Weight | 702.47 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | tert-butyl (E)-3-[4-chloro-2-(2-methoxy-2-oxoethyl)phenyl]prop-2-enoate;tert-butyl prop-2-enoate;methyl 2-(2-bromo-5-chlorophenyl)acetate |
| SMILES | C=CC(=O)OC(C)(C)C.COC(=O)Cc1cc(Cl)ccc1/C=C/C(=O)OC(C)(C)C.COC(=O)Cc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C16H19ClO4.C9H8BrClO2.C7H12O2/c1-16(2,3)21-14(18)8-6-11-5-7-13(17)9-12(11)10-15(19)20-4;1-13-9(12)5-6-4-7(11)2-3-8(6)10;1-5-6(8)9-7(2,3)4/h5-9H,10H2,1-4H3;2-4H,5H2,1H3;5H,1H2,2-4H3/b8-6+;; |
| InChIKey | ZEWWBQLMIRDOCQ-OVGXCEQFSA-N |
| XLogP | 7.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.47 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|