C17H16O6 — CID 57402432
(E)-1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-2-(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 57402432) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-2-(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-2-(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 57402432 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-hydroxy-2-(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(O)ccc1/C=C/C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H16O6/c1-22-10-23-17-9-13(19)4-2-11(17)3-7-15(20)14-6-5-12(18)8-16(14)21/h2-9,18-19,21H,10H2,1H3/b7-3+ |
| InChIKey | BASVKIUIZBYGSE-XVNBXDOJSA-N |
| XLogP | 2.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|