C16H14O5 — CID 139808066
1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-2-methoxyphenyl)prop-2-en-1-one (PubChem CID 139808066) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139808066 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(O)ccc1C=CC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H14O5/c1-21-16-9-12(18)4-2-10(16)3-7-14(19)13-6-5-11(17)8-15(13)20/h2-9,17-18,20H,1H3 |
| InChIKey | IGUNABDNSZWUFR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|