C37H48N2O — CID 129320347
2-[(2E,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phenazine (PubChem CID 129320347) has the molecular formula C37H48N2O and a molecular weight of 536.80 g/mol. Its IUPAC name is 2-[(2E,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phenazine.
| Compound Name | 2-[(2E,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phenazine |
|---|---|
| PubChem CID | 129320347 |
| Molecular Formula | C37H48N2O |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.38 |
| IUPAC Name | 2-[(2E,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenoxy]phenazine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COc1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C37H48N2O/c1-28(2)13-9-14-29(3)15-10-16-30(4)17-11-18-31(5)19-12-20-32(6)25-26-40-33-23-24-36-37(27-33)39-35-22-8-7-21-34(35)38-36/h7-8,13,15,17,19,21-25,27H,9-12,14,16,18,20,26H2,1-6H3/b29-15+,30-17+,31-19+,32-25+ |
| InChIKey | AOZDZCJPOWENSD-QVNVCYKHSA-N |
| XLogP | 11.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|