C29H35NO2S — CID 123265772
1,4-dimethyl-7-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenothiazin-3-one (PubChem CID 123265772) has the molecular formula C29H35NO2S and a molecular weight of 461.67 g/mol. Its IUPAC name is 1,4-dimethyl-7-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenothiazin-3-one.
| Compound Name | 1,4-dimethyl-7-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenothiazin-3-one |
|---|---|
| PubChem CID | 123265772 |
| Molecular Formula | C29H35NO2S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 1,4-dimethyl-7-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenothiazin-3-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOc1ccc2nc3c(C)cc(=O)c(C)c-3sc2c1 |
| InChI | InChI=1S/C29H35NO2S/c1-19(2)9-7-10-20(3)11-8-12-21(4)15-16-32-24-13-14-25-27(18-24)33-29-23(6)26(31)17-22(5)28(29)30-25/h9,11,13-15,17-18H,7-8,10,12,16H2,1-6H3 |
| InChIKey | KUZOJWFLUIUNHR-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|