C24H36O — CID 59672021
1,3,5-trimethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene (PubChem CID 59672021) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene.
| Compound Name | 1,3,5-trimethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene |
|---|---|
| PubChem CID | 59672021 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 1,3,5-trimethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H36O/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-25-24-22(6)16-21(5)17-23(24)7/h10,12,14,16-17H,8-9,11,13,15H2,1-7H3/b19-12+,20-14+ |
| InChIKey | OPGSNYHPTDUCBQ-LCAIAVFMSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|