C22H26F4O3 — CID 10765373
2,3,5,6-tetrafluoro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzoic acid (PubChem CID 10765373) has the molecular formula C22H26F4O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzoic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzoic acid |
|---|---|
| PubChem CID | 10765373 |
| Molecular Formula | C22H26F4O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COc1c(F)c(F)c(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C22H26F4O3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-29-21-19(25)17(23)16(22(27)28)18(24)20(21)26/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,27,28)/b14-9+,15-11+ |
| InChIKey | SKPNCBAXCKJRNM-YFVJMOTDSA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|