C17H21F3O4S — CID 10738414
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,4,5-trifluoro-6-methylsulfonylphenol (PubChem CID 10738414) has the molecular formula C17H21F3O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,4,5-trifluoro-6-methylsulfonylphenol.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,4,5-trifluoro-6-methylsulfonylphenol |
|---|---|
| PubChem CID | 10738414 |
| Molecular Formula | C17H21F3O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2,4,5-trifluoro-6-methylsulfonylphenol |
| SMILES | CC(C)=CCC/C(C)=C/COc1c(F)c(O)c(S(C)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C17H21F3O4S/c1-10(2)6-5-7-11(3)8-9-24-16-12(18)13(19)17(25(4,22)23)15(21)14(16)20/h6,8,21H,5,7,9H2,1-4H3/b11-8+ |
| InChIKey | WXIJXFQPSKUNQV-DHZHZOJOSA-N |
| XLogP | 4.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|