C21H26F3NaO5S — CID 101088238
sodium 2,4,5-trifluoro-6-sulfo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenolate (PubChem CID 101088238) has the molecular formula C21H26F3NaO5S and a molecular weight of 470.49 g/mol. Its IUPAC name is sodium 2,4,5-trifluoro-6-sulfo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenolate.
| Compound Name | sodium 2,4,5-trifluoro-6-sulfo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenolate |
|---|---|
| PubChem CID | 101088238 |
| Molecular Formula | C21H26F3NaO5S |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | sodium 2,4,5-trifluoro-6-sulfo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]phenolate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COc1c(F)c([O-])c(S(=O)(=O)O)c(F)c1F.[Na+] |
| InChI | InChI=1S/C21H27F3O5S.Na/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-29-20-16(22)17(23)21(30(26,27)28)19(25)18(20)24;/h7,9,11,25H,5-6,8,10,12H2,1-4H3,(H,26,27,28);/q;+1/p-1/b14-9+,15-11+; |
| InChIKey | VXTPJNVZMSRODL-NDHHSALASA-M |
| XLogP | 2.23 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|