C24H34O5 — CID 162845189
(2R)-1-[3-acetyl-4-(3,7-dimethylocta-2,6-dienoxy)-2,6-dihydroxy-5-methylphenyl]-2-methylbutan-1-one (PubChem CID 162845189) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (2R)-1-[3-acetyl-4-(3,7-dimethylocta-2,6-dienoxy)-2,6-dihydroxy-5-methylphenyl]-2-methylbutan-1-one.
| Compound Name | (2R)-1-[3-acetyl-4-(3,7-dimethylocta-2,6-dienoxy)-2,6-dihydroxy-5-methylphenyl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 162845189 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (2R)-1-[3-acetyl-4-(3,7-dimethylocta-2,6-dienoxy)-2,6-dihydroxy-5-methylphenyl]-2-methylbutan-1-one |
| SMILES | CC[C@@H](C)C(=O)c1c(O)c(C)c(OCC=C(C)CCC=C(C)C)c(C(C)=O)c1O |
| InChI | InChI=1S/C24H34O5/c1-8-16(5)21(26)20-22(27)17(6)24(19(18(7)25)23(20)28)29-13-12-15(4)11-9-10-14(2)3/h10,12,16,27-28H,8-9,11,13H2,1-7H3/t16-/m1/s1 |
| InChIKey | SLMXSSJVARUOAM-MRXNPFEDSA-N |
| XLogP | 5.91 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|