C38H48O11 — CID 163073824
[2-ethyl-3-methyl-6-oxo-5-[[2,4,6-triacetyloxy-3-(3,7-dimethylocta-2,6-dienyl)-5-(2-methylbutanoyl)phenyl]methyl]pyran-4-yl] acetate (PubChem CID 163073824) has the molecular formula C38H48O11 and a molecular weight of 680.79 g/mol. Its IUPAC name is [2-ethyl-3-methyl-6-oxo-5-[[2,4,6-triacetyloxy-3-(3,7-dimethylocta-2,6-dienyl)-5-(2-methylbutanoyl)phenyl]methyl]pyran-4-yl] acetate.
| Compound Name | [2-ethyl-3-methyl-6-oxo-5-[[2,4,6-triacetyloxy-3-(3,7-dimethylocta-2,6-dienyl)-5-(2-methylbutanoyl)phenyl]methyl]pyran-4-yl] acetate |
|---|---|
| PubChem CID | 163073824 |
| Molecular Formula | C38H48O11 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | [2-ethyl-3-methyl-6-oxo-5-[[2,4,6-triacetyloxy-3-(3,7-dimethylocta-2,6-dienyl)-5-(2-methylbutanoyl)phenyl]methyl]pyran-4-yl] acetate |
| SMILES | CCc1oc(=O)c(Cc2c(OC(C)=O)c(CC=C(C)CCC=C(C)C)c(OC(C)=O)c(C(=O)C(C)CC)c2OC(C)=O)c(OC(C)=O)c1C |
| InChI | InChI=1S/C38H48O11/c1-12-22(6)33(43)32-36(47-26(10)41)28(18-17-21(5)16-14-15-20(3)4)35(46-25(9)40)29(37(32)48-27(11)42)19-30-34(45-24(8)39)23(7)31(13-2)49-38(30)44/h15,17,22H,12-14,16,18-19H2,1-11H3 |
| InChIKey | BTBAMGHCMIUGHZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 152.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|