C31H44O4 — CID 134238195
[3-acetyloxy-2,4-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methylphenyl] acetate (PubChem CID 134238195) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is [3-acetyloxy-2,4-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methylphenyl] acetate.
| Compound Name | [3-acetyloxy-2,4-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methylphenyl] acetate |
|---|---|
| PubChem CID | 134238195 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | [3-acetyloxy-2,4-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-5-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(C)c(C/C=C(\C)CCC=C(C)C)c(OC(C)=O)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C31H44O4/c1-21(2)12-10-14-23(5)16-18-28-25(7)20-30(34-26(8)32)29(31(28)35-27(9)33)19-17-24(6)15-11-13-22(3)4/h12-13,16-17,20H,10-11,14-15,18-19H2,1-9H3/b23-16+,24-17+ |
| InChIKey | KEMRQPUIGNZRPV-WPHIWBHXSA-N |
| XLogP | 8.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|