C23H32O4 — CID 163066717
[2,4-dihydroxy-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)phenyl] acetate (PubChem CID 163066717) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [2,4-dihydroxy-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)phenyl] acetate.
| Compound Name | [2,4-dihydroxy-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)phenyl] acetate |
|---|---|
| PubChem CID | 163066717 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [2,4-dihydroxy-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)phenyl] acetate |
| SMILES | CC(=O)Oc1c(O)cc(O)cc1CC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C23H32O4/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-14-21(25)15-22(26)23(20)27-19(5)24/h8,10,12,14-15,25-26H,6-7,9,11,13H2,1-5H3 |
| InChIKey | ZUHZDCFUDNTXNH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|