C34H46O8 — CID 139711955
[2,4,5-triacetyloxy-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenyl] acetate (PubChem CID 139711955) has the molecular formula C34H46O8 and a molecular weight of 582.73 g/mol. Its IUPAC name is [2,4,5-triacetyloxy-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenyl] acetate.
| Compound Name | [2,4,5-triacetyloxy-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenyl] acetate |
|---|---|
| PubChem CID | 139711955 |
| Molecular Formula | C34H46O8 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | [2,4,5-triacetyloxy-3-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)phenyl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c(OC(C)=O)c(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)c1OC(C)=O |
| InChI | InChI=1S/C34H46O8/c1-22(2)13-10-14-23(3)15-11-16-24(4)17-12-18-25(5)19-20-30-33(41-28(8)37)31(39-26(6)35)21-32(40-27(7)36)34(30)42-29(9)38/h13,15,17,19,21H,10-12,14,16,18,20H2,1-9H3 |
| InChIKey | DZLYMBUUKGRENC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|