C22H32O6 — CID 11794855
1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]ethanone (PubChem CID 11794855) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]ethanone.
| Compound Name | 1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 11794855 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]ethanone |
| SMILES | COCOc1cc(OCOC)c(C(C)=O)c(O)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H32O6/c1-15(2)8-7-9-16(3)10-11-18-19(27-13-25-5)12-20(28-14-26-6)21(17(4)23)22(18)24/h8,10,12,24H,7,9,11,13-14H2,1-6H3/b16-10+ |
| InChIKey | CBWRMMPWRXASFH-MHWRWJLKSA-N |
| XLogP | 4.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|