C28H40O4 — CID 46934836
1-[3,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]ethanone (PubChem CID 46934836) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is 1-[3,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]ethanone.
| Compound Name | 1-[3,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 46934836 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 1-[3,5-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]ethanone |
| SMILES | CC(=O)c1c(O)c(C/C=C(\C)CCC=C(C)C)c(O)c(C/C=C(\C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C28H40O4/c1-18(2)10-8-12-20(5)14-16-23-26(30)24(28(32)25(22(7)29)27(23)31)17-15-21(6)13-9-11-19(3)4/h10-11,14-15,30-32H,8-9,12-13,16-17H2,1-7H3/b20-14+,21-15+ |
| InChIKey | ASZPGUREWJTOPQ-OZNQKUEASA-N |
| XLogP | 7.48 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|