C31H46O4 — CID 54327994
1-[3,5-bis(3,7-dimethylocta-2,6-dienyl)-2,4,6-trihydroxyphenyl]-3-methylbutan-1-one (PubChem CID 54327994) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 1-[3,5-bis(3,7-dimethylocta-2,6-dienyl)-2,4,6-trihydroxyphenyl]-3-methylbutan-1-one.
| Compound Name | 1-[3,5-bis(3,7-dimethylocta-2,6-dienyl)-2,4,6-trihydroxyphenyl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 54327994 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 1-[3,5-bis(3,7-dimethylocta-2,6-dienyl)-2,4,6-trihydroxyphenyl]-3-methylbutan-1-one |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)c(CC=C(C)CCC=C(C)C)c(O)c(C(=O)CC(C)C)c1O |
| InChI | InChI=1S/C31H46O4/c1-20(2)11-9-13-23(7)15-17-25-29(33)26(18-16-24(8)14-10-12-21(3)4)31(35)28(30(25)34)27(32)19-22(5)6/h11-12,15-16,22,33-35H,9-10,13-14,17-19H2,1-8H3 |
| InChIKey | SWHVEOQYNVJUSC-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|