C35H54O2 — CID 143843457
ethane;[4-pent-1-en-2-yl-2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]phenyl] acetate (PubChem CID 143843457) has the molecular formula C35H54O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is ethane;[4-pent-1-en-2-yl-2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]phenyl] acetate.
| Compound Name | ethane;[4-pent-1-en-2-yl-2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]phenyl] acetate |
|---|---|
| PubChem CID | 143843457 |
| Molecular Formula | C35H54O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | ethane;[4-pent-1-en-2-yl-2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]phenyl] acetate |
| SMILES | C=C(CCC)c1ccc(OC(C)=O)c(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c1.CC |
| InChI | InChI=1S/C33H48O2.C2H6/c1-9-13-29(7)31-22-23-33(35-30(8)34)32(24-31)21-20-28(6)19-12-18-27(5)17-11-16-26(4)15-10-14-25(2)3;1-2/h14,16,18,20,22-24H,7,9-13,15,17,19,21H2,1-6,8H3;1-2H3/b26-16+,27-18+,28-20+; |
| InChIKey | MJBNGKKIEUCOIQ-DQVOEZSZSA-N |
| XLogP | 11.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|