C29H42O5 — CID 11733391
[(4E,8E,12E)-14-(2-acetyloxy-5-hydroxy-3,4-dimethylphenyl)-4,8,12-trimethyltetradeca-4,8,12-trienyl] acetate (PubChem CID 11733391) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [(4E,8E,12E)-14-(2-acetyloxy-5-hydroxy-3,4-dimethylphenyl)-4,8,12-trimethyltetradeca-4,8,12-trienyl] acetate.
| Compound Name | [(4E,8E,12E)-14-(2-acetyloxy-5-hydroxy-3,4-dimethylphenyl)-4,8,12-trimethyltetradeca-4,8,12-trienyl] acetate |
|---|---|
| PubChem CID | 11733391 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [(4E,8E,12E)-14-(2-acetyloxy-5-hydroxy-3,4-dimethylphenyl)-4,8,12-trimethyltetradeca-4,8,12-trienyl] acetate |
| SMILES | CC(=O)OCCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(O)c(C)c(C)c1OC(C)=O |
| InChI | InChI=1S/C29H42O5/c1-20(11-8-13-21(2)15-10-18-33-25(6)30)12-9-14-22(3)16-17-27-19-28(32)23(4)24(5)29(27)34-26(7)31/h12-13,16,19,32H,8-11,14-15,17-18H2,1-7H3/b20-12+,21-13+,22-16+ |
| InChIKey | XGJGLOCIAJNOGB-GDFIKGLMSA-N |
| XLogP | 7.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|