C28H32O4 — CID 142960819
[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-3-methylphenyl] acetate (PubChem CID 142960819) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-3-methylphenyl] acetate.
| Compound Name | [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-3-methylphenyl] acetate |
|---|---|
| PubChem CID | 142960819 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-3-methylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(=O)/C=C/c2ccc(O)cc2)ccc(C)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H32O4/c1-19(2)7-6-8-20(3)9-16-25-21(4)10-17-26(28(25)32-22(5)29)27(31)18-13-23-11-14-24(30)15-12-23/h7,9-15,17-18,30H,6,8,16H2,1-5H3/b18-13+,20-9+ |
| InChIKey | JKGQBGKFTLSSKA-ABVNMXPUSA-N |
| XLogP | 6.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|