C27H36O6 — CID 162897676
8-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-[(2R)-2-methylbutanoyl]chromen-2-one (PubChem CID 162897676) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is 8-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-[(2R)-2-methylbutanoyl]chromen-2-one.
| Compound Name | 8-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-[(2R)-2-methylbutanoyl]chromen-2-one |
|---|---|
| PubChem CID | 162897676 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 8-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-[(2R)-2-methylbutanoyl]chromen-2-one |
| SMILES | CC[C@@H](C)C(=O)c1c(O)c(CC=C(C)CCC=C(C)C)c2oc(=O)cc([C@@H](O)CC)c2c1O |
| InChI | InChI=1S/C27H36O6/c1-7-17(6)24(30)23-25(31)18(13-12-16(5)11-9-10-15(3)4)27-22(26(23)32)19(20(28)8-2)14-21(29)33-27/h10,12,14,17,20,28,31-32H,7-9,11,13H2,1-6H3/t17-,20+/m1/s1 |
| InChIKey | AGOSDMDNYICYIT-XLIONFOSSA-N |
| XLogP | 6.11 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|