C25H32O6 — CID 44546196
6-butanoyl-8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]chromen-2-one (PubChem CID 44546196) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 6-butanoyl-8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]chromen-2-one.
| Compound Name | 6-butanoyl-8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]chromen-2-one |
|---|---|
| PubChem CID | 44546196 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 6-butanoyl-8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]chromen-2-one |
| SMILES | CCCC(=O)c1c(O)c(C/C=C(\C)CC=C(C)C)c2oc(=O)cc([C@@H](O)CC)c2c1O |
| InChI | InChI=1S/C25H32O6/c1-6-8-19(27)22-23(29)16(12-11-15(5)10-9-14(3)4)25-21(24(22)30)17(18(26)7-2)13-20(28)31-25/h9,11,13,18,26,29-30H,6-8,10,12H2,1-5H3/b15-11+/t18-/m0/s1 |
| InChIKey | CJBWUWSCEULPRM-OTMARIDSSA-N |
| XLogP | 5.48 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|