C26H34O6 — CID 44546197
8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-(3-methylbutanoyl)chromen-2-one (PubChem CID 44546197) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-(3-methylbutanoyl)chromen-2-one.
| Compound Name | 8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-(3-methylbutanoyl)chromen-2-one |
|---|---|
| PubChem CID | 44546197 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 8-[(2E)-3,6-dimethylhepta-2,5-dienyl]-5,7-dihydroxy-4-[(1S)-1-hydroxypropyl]-6-(3-methylbutanoyl)chromen-2-one |
| SMILES | CC[C@H](O)c1cc(=O)oc2c(C/C=C(\C)CC=C(C)C)c(O)c(C(=O)CC(C)C)c(O)c12 |
| InChI | InChI=1S/C26H34O6/c1-7-19(27)18-13-21(29)32-26-17(11-10-16(6)9-8-14(2)3)24(30)23(25(31)22(18)26)20(28)12-15(4)5/h8,10,13,15,19,27,30-31H,7,9,11-12H2,1-6H3/b16-10+/t19-/m0/s1 |
| InChIKey | ISWURQFFQDRPNO-XLCPLWEUSA-N |
| XLogP | 5.72 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|