C20H28O4 — CID 162925245
1-[4-(2,6-dimethylhepta-1,5-dienoxy)-2,6-dihydroxyphenyl]-2-methylbutan-1-one (PubChem CID 162925245) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylhepta-1,5-dienoxy)-2,6-dihydroxyphenyl]-2-methylbutan-1-one.
| Compound Name | 1-[4-(2,6-dimethylhepta-1,5-dienoxy)-2,6-dihydroxyphenyl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 162925245 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-[4-(2,6-dimethylhepta-1,5-dienoxy)-2,6-dihydroxyphenyl]-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1c(O)cc(OC=C(C)CCC=C(C)C)cc1O |
| InChI | InChI=1S/C20H28O4/c1-6-15(5)20(23)19-17(21)10-16(11-18(19)22)24-12-14(4)9-7-8-13(2)3/h8,10-12,15,21-22H,6-7,9H2,1-5H3 |
| InChIKey | SKTDZBVNXYOMFX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|