C21H30O5 — CID 57379193
1-[2,4-dihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]phenyl]-2-methylbutan-1-one (PubChem CID 57379193) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[2,4-dihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]phenyl]-2-methylbutan-1-one.
| Compound Name | 1-[2,4-dihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]phenyl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 57379193 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[2,4-dihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienoxy]phenyl]-2-methylbutan-1-one |
| SMILES | C=C(C)C(O)CC/C(C)=C/COc1cc(O)cc(O)c1C(=O)C(C)CC |
| InChI | InChI=1S/C21H30O5/c1-6-15(5)21(25)20-18(24)11-16(22)12-19(20)26-10-9-14(4)7-8-17(23)13(2)3/h9,11-12,15,17,22-24H,2,6-8,10H2,1,3-5H3/b14-9+ |
| InChIKey | BVPWFRDKPLQOKL-NTEUORMPSA-N |
| XLogP | 4.37 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|