C19H26O4 — CID 163031152
methyl 3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-4-methoxybenzoate (PubChem CID 163031152) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-4-methoxybenzoate.
| Compound Name | methyl 3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 163031152 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 3-[(6R)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-4-methoxybenzoate |
| SMILES | C=C(C)[C@H](O)CCC(C)=CCc1cc(C(=O)OC)ccc1OC |
| InChI | InChI=1S/C19H26O4/c1-13(2)17(20)10-7-14(3)6-8-15-12-16(19(21)23-5)9-11-18(15)22-4/h6,9,11-12,17,20H,1,7-8,10H2,2-5H3/t17-/m1/s1 |
| InChIKey | ZJZJHUQQKRCMTI-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|