C30H46O6 — CID 52912705
methyl 3-[(2E,6E,10E,14R)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl]-4-(methoxymethoxy)benzoate (PubChem CID 52912705) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is methyl 3-[(2E,6E,10E,14R)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl]-4-(methoxymethoxy)benzoate.
| Compound Name | methyl 3-[(2E,6E,10E,14R)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl]-4-(methoxymethoxy)benzoate |
|---|---|
| PubChem CID | 52912705 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | methyl 3-[(2E,6E,10E,14R)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl]-4-(methoxymethoxy)benzoate |
| SMILES | COCOc1ccc(C(=O)OC)cc1C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H46O6/c1-22(11-9-13-24(3)15-19-28(31)30(4,5)33)10-8-12-23(2)14-16-25-20-26(29(32)35-7)17-18-27(25)36-21-34-6/h10,13-14,17-18,20,28,31,33H,8-9,11-12,15-16,19,21H2,1-7H3/b22-10+,23-14+,24-13+/t28-/m1/s1 |
| InChIKey | GIEFUJAHGJYYQI-YSYWSWINSA-N |
| XLogP | 6.31 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|