C28H43NO3 — CID 143619250
methyl 4-ethoxy-3-[propyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate (PubChem CID 143619250) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is methyl 4-ethoxy-3-[propyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate.
| Compound Name | methyl 4-ethoxy-3-[propyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate |
|---|---|
| PubChem CID | 143619250 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | methyl 4-ethoxy-3-[propyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoate |
| SMILES | CCCN(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c1cc(C(=O)OC)ccc1OCC |
| InChI | InChI=1S/C28H43NO3/c1-8-19-29(26-21-25(28(30)31-7)16-17-27(26)32-9-2)20-18-24(6)15-11-14-23(5)13-10-12-22(3)4/h12,14,16-18,21H,8-11,13,15,19-20H2,1-7H3/b23-14+,24-18+ |
| InChIKey | UFXJPKIICCCYCM-WVDADPJUSA-N |
| XLogP | 7.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|