C27H45NO — CID 154621173
N-decyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxyaniline (PubChem CID 154621173) has the molecular formula C27H45NO and a molecular weight of 399.66 g/mol. Its IUPAC name is N-decyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxyaniline.
| Compound Name | N-decyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 154621173 |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | N-decyl-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxyaniline |
| SMILES | CCCCCCCCCCN(C/C=C(\C)CCC=C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H45NO/c1-6-7-8-9-10-11-12-13-22-28(26-17-19-27(29-5)20-18-26)23-21-25(4)16-14-15-24(2)3/h15,17-21H,6-14,16,22-23H2,1-5H3/b25-21+ |
| InChIKey | URPXOXLUZQUPAY-NJNXFGOHSA-N |
| XLogP | 8.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|