C25H38FNO — CID 142550002
N-decyl-N-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]-4-methoxyaniline (PubChem CID 142550002) has the molecular formula C25H38FNO and a molecular weight of 387.58 g/mol. Its IUPAC name is N-decyl-N-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]-4-methoxyaniline.
| Compound Name | N-decyl-N-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 142550002 |
| Molecular Formula | C25H38FNO |
| Molecular Weight | 387.58 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | N-decyl-N-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]-4-methoxyaniline |
| SMILES | C=C/C(F)=C\C=C(/C)CN(CCCCCCCCCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H38FNO/c1-5-7-8-9-10-11-12-13-20-27(21-22(3)14-15-23(26)6-2)24-16-18-25(28-4)19-17-24/h6,14-19H,2,5,7-13,20-21H2,1,3-4H3/b22-14+,23-15+ |
| InChIKey | SYMGGMZPEHLOIL-HOFJZWJUSA-N |
| XLogP | 7.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.58 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|