C24H36BrNO — CID 138519643
N-[(4-bromocyclohexa-1,5-dien-1-yl)methyl]-N-decyl-4-methoxyaniline (PubChem CID 138519643) has the molecular formula C24H36BrNO and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[(4-bromocyclohexa-1,5-dien-1-yl)methyl]-N-decyl-4-methoxyaniline.
| Compound Name | N-[(4-bromocyclohexa-1,5-dien-1-yl)methyl]-N-decyl-4-methoxyaniline |
|---|---|
| PubChem CID | 138519643 |
| Molecular Formula | C24H36BrNO |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[(4-bromocyclohexa-1,5-dien-1-yl)methyl]-N-decyl-4-methoxyaniline |
| SMILES | CCCCCCCCCCN(CC1=CCC(Br)C=C1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H36BrNO/c1-3-4-5-6-7-8-9-10-19-26(20-21-11-13-22(25)14-12-21)23-15-17-24(27-2)18-16-23/h11-13,15-18,22H,3-10,14,19-20H2,1-2H3 |
| InChIKey | IRGQWFSFZDFCDG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|