C20H37NO — CID 138518670
N-hexyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexan-1-amine (PubChem CID 138518670) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is N-hexyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexan-1-amine.
| Compound Name | N-hexyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 138518670 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | N-hexyl-N-[(4-methoxycyclohexa-1,5-dien-1-yl)methyl]hexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)CC1=CCC(OC)C=C1 |
| InChI | InChI=1S/C20H37NO/c1-4-6-8-10-16-21(17-11-9-7-5-2)18-19-12-14-20(22-3)15-13-19/h12-14,20H,4-11,15-18H2,1-3H3 |
| InChIKey | KCKRVZUNUTTZJS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|