C24H35NO3 — CID 138519624
N-(3a,7a-dihydro-1,3-benzodioxol-5-ylmethyl)-4-methoxy-N-nonylaniline (PubChem CID 138519624) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-(3a,7a-dihydro-1,3-benzodioxol-5-ylmethyl)-4-methoxy-N-nonylaniline.
| Compound Name | N-(3a,7a-dihydro-1,3-benzodioxol-5-ylmethyl)-4-methoxy-N-nonylaniline |
|---|---|
| PubChem CID | 138519624 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | N-(3a,7a-dihydro-1,3-benzodioxol-5-ylmethyl)-4-methoxy-N-nonylaniline |
| SMILES | CCCCCCCCCN(CC1=CC2OCOC2C=C1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H35NO3/c1-3-4-5-6-7-8-9-16-25(21-11-13-22(26-2)14-12-21)18-20-10-15-23-24(17-20)28-19-27-23/h10-15,17,23-24H,3-9,16,18-19H2,1-2H3 |
| InChIKey | MKOBHHCOBDLDCW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|