C24H32F3NO — CID 142550061
4-methoxy-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]-N-octylaniline (PubChem CID 142550061) has the molecular formula C24H32F3NO and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-methoxy-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]-N-octylaniline.
| Compound Name | 4-methoxy-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]-N-octylaniline |
|---|---|
| PubChem CID | 142550061 |
| Molecular Formula | C24H32F3NO |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 4-methoxy-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]-N-octylaniline |
| SMILES | CCCCCCCCN(Cc1ccc(C)c(C(F)(F)F)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H32F3NO/c1-4-5-6-7-8-9-16-28(21-12-14-22(29-3)15-13-21)18-20-11-10-19(2)23(17-20)24(25,26)27/h10-15,17H,4-9,16,18H2,1-3H3 |
| InChIKey | QTJIGYKGWTZGQN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|