C19H22F3NO — CID 154621321
N-butyl-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 154621321) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is N-butyl-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | N-butyl-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 154621321 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-butyl-4-methoxy-N-[[3-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | CCCCN(Cc1cccc(C(F)(F)F)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22F3NO/c1-3-4-12-23(17-8-10-18(24-2)11-9-17)14-15-6-5-7-16(13-15)19(20,21)22/h5-11,13H,3-4,12,14H2,1-2H3 |
| InChIKey | OEYHXHPLHHCFPF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|