C25H41NO — CID 138518689
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-octylaniline (PubChem CID 138518689) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-octylaniline.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-octylaniline |
|---|---|
| PubChem CID | 138518689 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methoxy-N-octylaniline |
| SMILES | CCCCCCCCN(C/C=C(\C)CCC=C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H41NO/c1-6-7-8-9-10-11-20-26(24-15-17-25(27-5)18-16-24)21-19-23(4)14-12-13-22(2)3/h13,15-19H,6-12,14,20-21H2,1-5H3/b23-19+ |
| InChIKey | XJAWWSIVWJGXBS-FCDQGJHFSA-N |
| XLogP | 7.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|