C24H31NO2 — CID 69302470
N-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-N-(4-methoxyphenyl)aniline (PubChem CID 69302470) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-N-(4-methoxyphenyl)aniline.
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 69302470 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)-4-methoxy-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(CC=C(C)CCC=C(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H31NO2/c1-19(2)7-6-8-20(3)17-18-25(21-9-13-23(26-4)14-10-21)22-11-15-24(27-5)16-12-22/h7,9-17H,6,8,18H2,1-5H3 |
| InChIKey | PUTGFMQPDIOGCX-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|