C19H28O — CID 69088540
1-methoxy-4-[(3E)-2,4,8-trimethylnona-3,7-dienyl]benzene (PubChem CID 69088540) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-methoxy-4-[(3E)-2,4,8-trimethylnona-3,7-dienyl]benzene.
| Compound Name | 1-methoxy-4-[(3E)-2,4,8-trimethylnona-3,7-dienyl]benzene |
|---|---|
| PubChem CID | 69088540 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1-methoxy-4-[(3E)-2,4,8-trimethylnona-3,7-dienyl]benzene |
| SMILES | COc1ccc(CC(C)/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C19H28O/c1-15(2)7-6-8-16(3)13-17(4)14-18-9-11-19(20-5)12-10-18/h7,9-13,17H,6,8,14H2,1-5H3/b16-13+ |
| InChIKey | XCSLUSDKAMNDCU-DTQAZKPQSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|