C18H24O3 — CID 122226267
(2Z)-3-[(4-methoxyphenyl)methoxymethyl]-7-methylocta-2,6-dienal (PubChem CID 122226267) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2Z)-3-[(4-methoxyphenyl)methoxymethyl]-7-methylocta-2,6-dienal.
| Compound Name | (2Z)-3-[(4-methoxyphenyl)methoxymethyl]-7-methylocta-2,6-dienal |
|---|---|
| PubChem CID | 122226267 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2Z)-3-[(4-methoxyphenyl)methoxymethyl]-7-methylocta-2,6-dienal |
| SMILES | COc1ccc(COC/C(=C\C=O)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C18H24O3/c1-15(2)5-4-6-16(11-12-19)13-21-14-17-7-9-18(20-3)10-8-17/h5,7-12H,4,6,13-14H2,1-3H3/b16-11- |
| InChIKey | OUVVWTOHHZDWGW-WJDWOHSUSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|