C25H32O4 — CID 101454626
1-methoxy-4-[[(3E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]hepta-3,6-dienoxy]methyl]benzene (PubChem CID 101454626) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-methoxy-4-[[(3E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]hepta-3,6-dienoxy]methyl]benzene.
| Compound Name | 1-methoxy-4-[[(3E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]hepta-3,6-dienoxy]methyl]benzene |
|---|---|
| PubChem CID | 101454626 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-methoxy-4-[[(3E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]hepta-3,6-dienoxy]methyl]benzene |
| SMILES | C=CC/C(=C\CCOCc1ccc(OC)cc1)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H32O4/c1-4-6-21(16-18-29-20-23-10-14-25(27-3)15-11-23)7-5-17-28-19-22-8-12-24(26-2)13-9-22/h4,7-15H,1,5-6,16-20H2,2-3H3/b21-7+ |
| InChIKey | VLDUHDYFLKTLBC-QPSGOUHRSA-N |
| XLogP | 5.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|