C31H36O4 — CID 101454631
1-methoxy-4-[[(3E,6E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-phenylhepta-3,6-dienoxy]methyl]benzene (PubChem CID 101454631) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-methoxy-4-[[(3E,6E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-phenylhepta-3,6-dienoxy]methyl]benzene.
| Compound Name | 1-methoxy-4-[[(3E,6E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-phenylhepta-3,6-dienoxy]methyl]benzene |
|---|---|
| PubChem CID | 101454631 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1-methoxy-4-[[(3E,6E)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-phenylhepta-3,6-dienoxy]methyl]benzene |
| SMILES | COc1ccc(COCC/C=C(\C/C=C/c2ccccc2)CCOCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H36O4/c1-32-30-17-13-28(14-18-30)24-34-22-7-12-27(11-6-10-26-8-4-3-5-9-26)21-23-35-25-29-15-19-31(33-2)20-16-29/h3-6,8-10,12-20H,7,11,21-25H2,1-2H3/b10-6+,27-12+ |
| InChIKey | VLSPQMBIGZUBSL-UAXOEENISA-N |
| XLogP | 7.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|