C23H28O4 — CID 138967268
(2R,4S,6R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-[(E)-2-phenylethenyl]oxan-4-ol (PubChem CID 138967268) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (2R,4S,6R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-[(E)-2-phenylethenyl]oxan-4-ol.
| Compound Name | (2R,4S,6R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-[(E)-2-phenylethenyl]oxan-4-ol |
|---|---|
| PubChem CID | 138967268 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (2R,4S,6R)-2-[2-[(4-methoxyphenyl)methoxy]ethyl]-6-[(E)-2-phenylethenyl]oxan-4-ol |
| SMILES | COc1ccc(COCC[C@@H]2C[C@H](O)C[C@H](/C=C/c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H28O4/c1-25-21-10-8-19(9-11-21)17-26-14-13-23-16-20(24)15-22(27-23)12-7-18-5-3-2-4-6-18/h2-12,20,22-24H,13-17H2,1H3/b12-7+/t20-,22+,23-/m1/s1 |
| InChIKey | NJUKRCBKDPFHBT-XLZVPLBDSA-N |
| XLogP | 4.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|